C17H24INO4S — CID 14789144
[(3R,4S)-2-iodo-6-methyl-3-[(4-methylphenyl)sulfonylamino]hept-1-en-4-yl] acetate (PubChem CID 14789144) has the molecular formula C17H24INO4S and a molecular weight of 465.35 g/mol. Its IUPAC name is [(3R,4S)-2-iodo-6-methyl-3-[(4-methylphenyl)sulfonylamino]hept-1-en-4-yl] acetate.
| Compound Name | [(3R,4S)-2-iodo-6-methyl-3-[(4-methylphenyl)sulfonylamino]hept-1-en-4-yl] acetate |
|---|---|
| PubChem CID | 14789144 |
| Molecular Formula | C17H24INO4S |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | [(3R,4S)-2-iodo-6-methyl-3-[(4-methylphenyl)sulfonylamino]hept-1-en-4-yl] acetate |
| SMILES | C=C(I)[C@H](NS(=O)(=O)c1ccc(C)cc1)[C@H](CC(C)C)OC(C)=O |
| InChI | InChI=1S/C17H24INO4S/c1-11(2)10-16(23-14(5)20)17(13(4)18)19-24(21,22)15-8-6-12(3)7-9-15/h6-9,11,16-17,19H,4,10H2,1-3,5H3/t16-,17-/m0/s1 |
| InChIKey | HQAQDOSEUZRWJV-IRXDYDNUSA-N |
| XLogP | 3.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|