C16H21NO7S — CID 10339191
methyl (2S,3R)-2-[(4-methylphenyl)sulfonylamino]-3-(3-oxobutanoyloxy)butanoate (PubChem CID 10339191) has the molecular formula C16H21NO7S and a molecular weight of 371.41 g/mol. Its IUPAC name is methyl (2S,3R)-2-[(4-methylphenyl)sulfonylamino]-3-(3-oxobutanoyloxy)butanoate.
| Compound Name | methyl (2S,3R)-2-[(4-methylphenyl)sulfonylamino]-3-(3-oxobutanoyloxy)butanoate |
|---|---|
| PubChem CID | 10339191 |
| Molecular Formula | C16H21NO7S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | methyl (2S,3R)-2-[(4-methylphenyl)sulfonylamino]-3-(3-oxobutanoyloxy)butanoate |
| SMILES | COC(=O)[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H](C)OC(=O)CC(C)=O |
| InChI | InChI=1S/C16H21NO7S/c1-10-5-7-13(8-6-10)25(21,22)17-15(16(20)23-4)12(3)24-14(19)9-11(2)18/h5-8,12,15,17H,9H2,1-4H3/t12-,15+/m1/s1 |
| InChIKey | QXJZPSCKJCNFAY-DOMZBBRYSA-N |
| XLogP | 0.73 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|