C15H22N2O6S — CID 53389398
(2R)-2-[[carboxy-[(4-methylphenyl)sulfonylamino]methyl]amino]-4-methylpentanoic acid (PubChem CID 53389398) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is (2R)-2-[[carboxy-[(4-methylphenyl)sulfonylamino]methyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[carboxy-[(4-methylphenyl)sulfonylamino]methyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 53389398 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (2R)-2-[[carboxy-[(4-methylphenyl)sulfonylamino]methyl]amino]-4-methylpentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(N[C@H](CC(C)C)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H22N2O6S/c1-9(2)8-12(14(18)19)16-13(15(20)21)17-24(22,23)11-6-4-10(3)5-7-11/h4-7,9,12-13,16-17H,8H2,1-3H3,(H,18,19)(H,20,21)/t12-,13?/m1/s1 |
| InChIKey | SNRRPXBCOORGJD-PZORYLMUSA-N |
| XLogP | 0.77 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|