C18H21NO5S — CID 101187548
methyl 3-(2-hydroxyphenyl)-2-methyl-3-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 101187548) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is methyl 3-(2-hydroxyphenyl)-2-methyl-3-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-(2-hydroxyphenyl)-2-methyl-3-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 101187548 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | methyl 3-(2-hydroxyphenyl)-2-methyl-3-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(C)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1O |
| InChI | InChI=1S/C18H21NO5S/c1-12-8-10-14(11-9-12)25(22,23)19-17(13(2)18(21)24-3)15-6-4-5-7-16(15)20/h4-11,13,17,19-20H,1-3H3 |
| InChIKey | SYXWBTDXDGLQCT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|