C18H25NO2S — CID 134864996
N-[(2E)-1-cyclohexylpenta-2,4-dienyl]-4-methylbenzenesulfonamide (PubChem CID 134864996) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is N-[(2E)-1-cyclohexylpenta-2,4-dienyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2E)-1-cyclohexylpenta-2,4-dienyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134864996 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[(2E)-1-cyclohexylpenta-2,4-dienyl]-4-methylbenzenesulfonamide |
| SMILES | C=C/C=C/C(NS(=O)(=O)c1ccc(C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C18H25NO2S/c1-3-4-10-18(16-8-6-5-7-9-16)19-22(20,21)17-13-11-15(2)12-14-17/h3-4,10-14,16,18-19H,1,5-9H2,2H3/b10-4+ |
| InChIKey | WNBSFCKUNKALTN-ONNFQVAWSA-N |
| XLogP | 3.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|