C20H31N3O5S — CID 108563207
tert-butyl N-[3-[4-[(4-methylphenyl)sulfonylamino]piperidin-1-yl]-3-oxopropyl]carbamate (PubChem CID 108563207) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[(4-methylphenyl)sulfonylamino]piperidin-1-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[(4-methylphenyl)sulfonylamino]piperidin-1-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108563207 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | tert-butyl N-[3-[4-[(4-methylphenyl)sulfonylamino]piperidin-1-yl]-3-oxopropyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCN(C(=O)CCNC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H31N3O5S/c1-15-5-7-17(8-6-15)29(26,27)22-16-10-13-23(14-11-16)18(24)9-12-21-19(25)28-20(2,3)4/h5-8,16,22H,9-14H2,1-4H3,(H,21,25) |
| InChIKey | WIRJZCJDOIWWFT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |