C18H26O2 — CID 129363718
tert-butyl (2R)-2-cyclopentyl-2-(4-methylphenyl)acetate (PubChem CID 129363718) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is tert-butyl (2R)-2-cyclopentyl-2-(4-methylphenyl)acetate.
| Compound Name | tert-butyl (2R)-2-cyclopentyl-2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 129363718 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | tert-butyl (2R)-2-cyclopentyl-2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc([C@H](C(=O)OC(C)(C)C)C2CCCC2)cc1 |
| InChI | InChI=1S/C18H26O2/c1-13-9-11-15(12-10-13)16(14-7-5-6-8-14)17(19)20-18(2,3)4/h9-12,14,16H,5-8H2,1-4H3/t16-/m1/s1 |
| InChIKey | WVUNBBJLJPVTBU-MRXNPFEDSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |