C20H28O3 — CID 54337064
tert-butyl 2-cyclopentyl-2-[4-(3-hydroxyprop-1-enyl)phenyl]acetate (PubChem CID 54337064) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is tert-butyl 2-cyclopentyl-2-[4-(3-hydroxyprop-1-enyl)phenyl]acetate.
| Compound Name | tert-butyl 2-cyclopentyl-2-[4-(3-hydroxyprop-1-enyl)phenyl]acetate |
|---|---|
| PubChem CID | 54337064 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | tert-butyl 2-cyclopentyl-2-[4-(3-hydroxyprop-1-enyl)phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)C(c1ccc(C=CCO)cc1)C1CCCC1 |
| InChI | InChI=1S/C20H28O3/c1-20(2,3)23-19(22)18(16-8-4-5-9-16)17-12-10-15(11-13-17)7-6-14-21/h6-7,10-13,16,18,21H,4-5,8-9,14H2,1-3H3 |
| InChIKey | TWFJIPITSNMXOT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |