C28H39ClN2O3 — CID 19072530
tert-butyl 2-[4-[3-(2-butyl-4-chloro-5-formylimidazol-1-yl)propyl]phenyl]-2-cyclopentylacetate (PubChem CID 19072530) has the molecular formula C28H39ClN2O3 and a molecular weight of 487.08 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-(2-butyl-4-chloro-5-formylimidazol-1-yl)propyl]phenyl]-2-cyclopentylacetate.
| Compound Name | tert-butyl 2-[4-[3-(2-butyl-4-chloro-5-formylimidazol-1-yl)propyl]phenyl]-2-cyclopentylacetate |
|---|---|
| PubChem CID | 19072530 |
| Molecular Formula | C28H39ClN2O3 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | tert-butyl 2-[4-[3-(2-butyl-4-chloro-5-formylimidazol-1-yl)propyl]phenyl]-2-cyclopentylacetate |
| SMILES | CCCCc1nc(Cl)c(C=O)n1CCCc1ccc(C(C(=O)OC(C)(C)C)C2CCCC2)cc1 |
| InChI | InChI=1S/C28H39ClN2O3/c1-5-6-13-24-30-26(29)23(19-32)31(24)18-9-10-20-14-16-22(17-15-20)25(21-11-7-8-12-21)27(33)34-28(2,3)4/h14-17,19,21,25H,5-13,18H2,1-4H3 |
| InChIKey | GBIJXUZSHTZJQO-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|