C12H17ClN2O — CID 170566260
2-butyl-5-chloro-3-(cyclopropylmethyl)imidazole-4-carbaldehyde (PubChem CID 170566260) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 2-butyl-5-chloro-3-(cyclopropylmethyl)imidazole-4-carbaldehyde.
| Compound Name | 2-butyl-5-chloro-3-(cyclopropylmethyl)imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 170566260 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-butyl-5-chloro-3-(cyclopropylmethyl)imidazole-4-carbaldehyde |
| SMILES | CCCCc1nc(Cl)c(C=O)n1CC1CC1 |
| InChI | InChI=1S/C12H17ClN2O/c1-2-3-4-11-14-12(13)10(8-16)15(11)7-9-5-6-9/h8-9H,2-7H2,1H3 |
| InChIKey | AVOOCYADQQRMPT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|