C22H27ClN2O4 — CID 67646339
2-butyl-5-chloro-3-[[4-(2-cyclopentylacetyl)oxyphenyl]methyl]imidazole-4-carboxylic acid (PubChem CID 67646339) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-butyl-5-chloro-3-[[4-(2-cyclopentylacetyl)oxyphenyl]methyl]imidazole-4-carboxylic acid.
| Compound Name | 2-butyl-5-chloro-3-[[4-(2-cyclopentylacetyl)oxyphenyl]methyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67646339 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-butyl-5-chloro-3-[[4-(2-cyclopentylacetyl)oxyphenyl]methyl]imidazole-4-carboxylic acid |
| SMILES | CCCCc1nc(Cl)c(C(=O)O)n1Cc1ccc(OC(=O)CC2CCCC2)cc1 |
| InChI | InChI=1S/C22H27ClN2O4/c1-2-3-8-18-24-21(23)20(22(27)28)25(18)14-16-9-11-17(12-10-16)29-19(26)13-15-6-4-5-7-15/h9-12,15H,2-8,13-14H2,1H3,(H,27,28) |
| InChIKey | LZYXJQMIVTVZOU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|