C22H29IN2O3 — CID 67647336
[4-[[2-butyl-5-(hydroxymethyl)-4-iodoimidazol-1-yl]methyl]phenyl] 2-cyclopentylacetate (PubChem CID 67647336) has the molecular formula C22H29IN2O3 and a molecular weight of 496.39 g/mol. Its IUPAC name is [4-[[2-butyl-5-(hydroxymethyl)-4-iodoimidazol-1-yl]methyl]phenyl] 2-cyclopentylacetate.
| Compound Name | [4-[[2-butyl-5-(hydroxymethyl)-4-iodoimidazol-1-yl]methyl]phenyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 67647336 |
| Molecular Formula | C22H29IN2O3 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | [4-[[2-butyl-5-(hydroxymethyl)-4-iodoimidazol-1-yl]methyl]phenyl] 2-cyclopentylacetate |
| SMILES | CCCCc1nc(I)c(CO)n1Cc1ccc(OC(=O)CC2CCCC2)cc1 |
| InChI | InChI=1S/C22H29IN2O3/c1-2-3-8-20-24-22(23)19(15-26)25(20)14-17-9-11-18(12-10-17)28-21(27)13-16-6-4-5-7-16/h9-12,16,26H,2-8,13-15H2,1H3 |
| InChIKey | UFRWODWYMQNRSO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|