C22H31ClN2O4 — CID 54543532
methyl 2-[4-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]phenoxy]hexanoate (PubChem CID 54543532) has the molecular formula C22H31ClN2O4 and a molecular weight of 422.95 g/mol. Its IUPAC name is methyl 2-[4-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]phenoxy]hexanoate.
| Compound Name | methyl 2-[4-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 54543532 |
| Molecular Formula | C22H31ClN2O4 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | methyl 2-[4-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]phenoxy]hexanoate |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc(OC(CCCC)C(=O)OC)cc1 |
| InChI | InChI=1S/C22H31ClN2O4/c1-4-6-8-19(22(27)28-3)29-17-12-10-16(11-13-17)14-25-18(15-26)21(23)24-20(25)9-7-5-2/h10-13,19,26H,4-9,14-15H2,1-3H3 |
| InChIKey | ZEXWRLQQUXRTGM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |