C22H27ClN2O4 — CID 67741948
2-butyl-3-[[4-(2-carboxycyclohexyl)phenyl]methyl]-5-chloroimidazole-4-carboxylic acid (PubChem CID 67741948) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-butyl-3-[[4-(2-carboxycyclohexyl)phenyl]methyl]-5-chloroimidazole-4-carboxylic acid.
| Compound Name | 2-butyl-3-[[4-(2-carboxycyclohexyl)phenyl]methyl]-5-chloroimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67741948 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-butyl-3-[[4-(2-carboxycyclohexyl)phenyl]methyl]-5-chloroimidazole-4-carboxylic acid |
| SMILES | CCCCc1nc(Cl)c(C(=O)O)n1Cc1ccc(C2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C22H27ClN2O4/c1-2-3-8-18-24-20(23)19(22(28)29)25(18)13-14-9-11-15(12-10-14)16-6-4-5-7-17(16)21(26)27/h9-12,16-17H,2-8,13H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | NHDBJWIIOGRVJT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |