C26H43NO3 — CID 151849191
tert-butyl (2S)-2-[2-methoxy-2-(4-octylphenyl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 151849191) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-methoxy-2-(4-octylphenyl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[2-methoxy-2-(4-octylphenyl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 151849191 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | tert-butyl (2S)-2-[2-methoxy-2-(4-octylphenyl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCc1ccc(C(C[C@@H]2CCCN2C(=O)OC(C)(C)C)OC)cc1 |
| InChI | InChI=1S/C26H43NO3/c1-6-7-8-9-10-11-13-21-15-17-22(18-16-21)24(29-5)20-23-14-12-19-27(23)25(28)30-26(2,3)4/h15-18,23-24H,6-14,19-20H2,1-5H3/t23-,24?/m0/s1 |
| InChIKey | SIHPTXQWFGDWFW-UXMRNZNESA-N |
| XLogP | 7.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|