C29H41NO4 — CID 139719883
tert-butyl 2-[2-[2-[4-(4-methoxyphenyl)butyl]phenoxy]ethyl]piperidine-1-carboxylate (PubChem CID 139719883) has the molecular formula C29H41NO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[4-(4-methoxyphenyl)butyl]phenoxy]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[2-[4-(4-methoxyphenyl)butyl]phenoxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139719883 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | tert-butyl 2-[2-[2-[4-(4-methoxyphenyl)butyl]phenoxy]ethyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(CCCCc2ccccc2OCCC2CCCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H41NO4/c1-29(2,3)34-28(31)30-21-10-9-14-25(30)20-22-33-27-15-8-7-13-24(27)12-6-5-11-23-16-18-26(32-4)19-17-23/h7-8,13,15-19,25H,5-6,9-12,14,20-22H2,1-4H3 |
| InChIKey | LHARDPSUANCQHV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|