C24H31NO4 — CID 10524872
ethyl (2R)-2-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]pyrrolidine-1-carboxylate (PubChem CID 10524872) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is ethyl (2R)-2-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | ethyl (2R)-2-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10524872 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | ethyl (2R)-2-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC[C@@H]1CCOc1ccccc1CCc1cccc(OC)c1 |
| InChI | InChI=1S/C24H31NO4/c1-3-28-24(26)25-16-7-10-21(25)15-17-29-23-12-5-4-9-20(23)14-13-19-8-6-11-22(18-19)27-2/h4-6,8-9,11-12,18,21H,3,7,10,13-17H2,1-2H3/t21-/m1/s1 |
| InChIKey | NRFPTLHRDKHNLC-OAQYLSRUSA-N |
| XLogP | 4.87 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |