C26H35NO5 — CID 54279493
tert-butyl (2S)-2-[[2-[2-[3-(methoxymethoxy)phenyl]ethyl]phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 54279493) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-[2-[3-(methoxymethoxy)phenyl]ethyl]phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[2-[2-[3-(methoxymethoxy)phenyl]ethyl]phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54279493 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | tert-butyl (2S)-2-[[2-[2-[3-(methoxymethoxy)phenyl]ethyl]phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | COCOc1cccc(CCc2ccccc2OC[C@@H]2CCCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H35NO5/c1-26(2,3)32-25(28)27-16-8-11-22(27)18-30-24-13-6-5-10-21(24)15-14-20-9-7-12-23(17-20)31-19-29-4/h5-7,9-10,12-13,17,22H,8,11,14-16,18-19H2,1-4H3/t22-/m0/s1 |
| InChIKey | RPUGIDCRPYGDEJ-QFIPXVFZSA-N |
| XLogP | 5.23 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|