C25H33NO4 — CID 19423970
tert-butyl 3-[[2-[2-(3-methoxyphenyl)ethyl]phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 19423970) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is tert-butyl 3-[[2-[2-(3-methoxyphenyl)ethyl]phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-[2-(3-methoxyphenyl)ethyl]phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19423970 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | tert-butyl 3-[[2-[2-(3-methoxyphenyl)ethyl]phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | COc1cccc(CCc2ccccc2OCC2CCN(C(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C25H33NO4/c1-25(2,3)30-24(27)26-15-14-20(17-26)18-29-23-11-6-5-9-21(23)13-12-19-8-7-10-22(16-19)28-4/h5-11,16,20H,12-15,17-18H2,1-4H3 |
| InChIKey | ZFVVXDDWYVHOLN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |