C29H33NO5 — CID 10553785
[(3R,5R)-5-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]-1-methylpyrrolidin-3-yl] phenyl carbonate (PubChem CID 10553785) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is [(3R,5R)-5-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]-1-methylpyrrolidin-3-yl] phenyl carbonate.
| Compound Name | [(3R,5R)-5-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]-1-methylpyrrolidin-3-yl] phenyl carbonate |
|---|---|
| PubChem CID | 10553785 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | [(3R,5R)-5-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]-1-methylpyrrolidin-3-yl] phenyl carbonate |
| SMILES | COc1cccc(CCc2ccccc2OCC[C@@H]2C[C@@H](OC(=O)Oc3ccccc3)CN2C)c1 |
| InChI | InChI=1S/C29H33NO5/c1-30-21-27(35-29(31)34-25-11-4-3-5-12-25)20-24(30)17-18-33-28-14-7-6-10-23(28)16-15-22-9-8-13-26(19-22)32-2/h3-14,19,24,27H,15-18,20-21H2,1-2H3/t24-,27-/m1/s1 |
| InChIKey | TWEAOUDRQSTNEN-SHQCIBLASA-N |
| XLogP | 5.54 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|