C34H51NO4 — CID 139719888
[5-[2-[2-[4-(3-methoxyphenyl)butyl]phenoxy]ethyl]-1-methylpyrrolidin-3-yl] decanoate (PubChem CID 139719888) has the molecular formula C34H51NO4 and a molecular weight of 537.79 g/mol. Its IUPAC name is [5-[2-[2-[4-(3-methoxyphenyl)butyl]phenoxy]ethyl]-1-methylpyrrolidin-3-yl] decanoate.
| Compound Name | [5-[2-[2-[4-(3-methoxyphenyl)butyl]phenoxy]ethyl]-1-methylpyrrolidin-3-yl] decanoate |
|---|---|
| PubChem CID | 139719888 |
| Molecular Formula | C34H51NO4 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | [5-[2-[2-[4-(3-methoxyphenyl)butyl]phenoxy]ethyl]-1-methylpyrrolidin-3-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC1CC(CCOc2ccccc2CCCCc2cccc(OC)c2)N(C)C1 |
| InChI | InChI=1S/C34H51NO4/c1-4-5-6-7-8-9-10-22-34(36)39-32-26-30(35(2)27-32)23-24-38-33-21-14-13-19-29(33)18-12-11-16-28-17-15-20-31(25-28)37-3/h13-15,17,19-21,25,30,32H,4-12,16,18,22-24,26-27H2,1-3H3 |
| InChIKey | AUXAOESJYDWGAK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|