C22H30ClNO2 — CID 10738261
(2R)-2-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]-1-methylpyrrolidin-1-ium chloride (PubChem CID 10738261) has the molecular formula C22H30ClNO2 and a molecular weight of 375.94 g/mol. Its IUPAC name is (2R)-2-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]-1-methylpyrrolidin-1-ium chloride.
| Compound Name | (2R)-2-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]-1-methylpyrrolidin-1-ium chloride |
|---|---|
| PubChem CID | 10738261 |
| Molecular Formula | C22H30ClNO2 |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (2R)-2-[2-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]ethyl]-1-methylpyrrolidin-1-ium chloride |
| SMILES | COc1cccc(CCc2ccccc2OCC[C@H]2CCC[NH+]2C)c1.[Cl-] |
| InChI | InChI=1S/C22H29NO2.ClH/c1-23-15-6-9-20(23)14-16-25-22-11-4-3-8-19(22)13-12-18-7-5-10-21(17-18)24-2;/h3-5,7-8,10-11,17,20H,6,9,12-16H2,1-2H3;1H/t20-;/m1./s1 |
| InChIKey | YLZYGKTZDVFUGZ-VEIFNGETSA-N |
| XLogP | -0.07 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |