C22H33N3O — CID 67785073
3-[[4-(2-amino-1-cyclopentylethyl)phenyl]methyl]-2-butyl-5-methylimidazol-4-ol (PubChem CID 67785073) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is 3-[[4-(2-amino-1-cyclopentylethyl)phenyl]methyl]-2-butyl-5-methylimidazol-4-ol.
| Compound Name | 3-[[4-(2-amino-1-cyclopentylethyl)phenyl]methyl]-2-butyl-5-methylimidazol-4-ol |
|---|---|
| PubChem CID | 67785073 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 3-[[4-(2-amino-1-cyclopentylethyl)phenyl]methyl]-2-butyl-5-methylimidazol-4-ol |
| SMILES | CCCCc1nc(C)c(O)n1Cc1ccc(C(CN)C2CCCC2)cc1 |
| InChI | InChI=1S/C22H33N3O/c1-3-4-9-21-24-16(2)22(26)25(21)15-17-10-12-19(13-11-17)20(14-23)18-7-5-6-8-18/h10-13,18,20,26H,3-9,14-15,23H2,1-2H3 |
| InChIKey | OXAFVDRSWXDAED-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |