C25H29N3O3 — CID 175295208
[5-[(2-butyl-5-methyl-4-oxoquinazolin-3-yl)methyl]-2-pyridinyl] cyclopentanecarboxylate (PubChem CID 175295208) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is [5-[(2-butyl-5-methyl-4-oxoquinazolin-3-yl)methyl]-2-pyridinyl] cyclopentanecarboxylate.
| Compound Name | [5-[(2-butyl-5-methyl-4-oxoquinazolin-3-yl)methyl]-2-pyridinyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 175295208 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [5-[(2-butyl-5-methyl-4-oxoquinazolin-3-yl)methyl]-2-pyridinyl] cyclopentanecarboxylate |
| SMILES | CCCCc1nc2cccc(C)c2c(=O)n1Cc1ccc(OC(=O)C2CCCC2)nc1 |
| InChI | InChI=1S/C25H29N3O3/c1-3-4-12-21-27-20-11-7-8-17(2)23(20)24(29)28(21)16-18-13-14-22(26-15-18)31-25(30)19-9-5-6-10-19/h7-8,11,13-15,19H,3-6,9-10,12,16H2,1-2H3 |
| InChIKey | GYRYKDRBVCBMID-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |