C22H31NO3 — CID 144737186
[5-[2-(4-methylcyclohexyl)-2-oxoethyl]-2-pyridinyl] 4-methylcyclohexane-1-carboxylate (PubChem CID 144737186) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is [5-[2-(4-methylcyclohexyl)-2-oxoethyl]-2-pyridinyl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [5-[2-(4-methylcyclohexyl)-2-oxoethyl]-2-pyridinyl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 144737186 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | [5-[2-(4-methylcyclohexyl)-2-oxoethyl]-2-pyridinyl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)Cc2ccc(OC(=O)C3CCC(C)CC3)nc2)CC1 |
| InChI | InChI=1S/C22H31NO3/c1-15-3-8-18(9-4-15)20(24)13-17-7-12-21(23-14-17)26-22(25)19-10-5-16(2)6-11-19/h7,12,14-16,18-19H,3-6,8-11,13H2,1-2H3 |
| InChIKey | NSAPOQILQFSKGW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |