About (5-propyl-2-pyridinyl) propanoate
(5-propyl-2-pyridinyl) propanoate (PubChem CID 146561214) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is (5-propyl-2-pyridinyl) propanoate.
Molecular Properties
| Compound Name | (5-propyl-2-pyridinyl) propanoate |
| PubChem CID | 146561214 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (5-propyl-2-pyridinyl) propanoate |
| SMILES | CCCc1ccc(OC(=O)CC)nc1 |
| InChI | InChI=1S/C11H15NO2/c1-3-5-9-6-7-10(12-8-9)14-11(13)4-2/h6-8H,3-5H2,1-2H3 |
| InChIKey | PLZKJKZJIUGOAR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-propyl-2-pyridinyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-propyl-2-pyridinyl) propanoate?
The IUPAC name of (5-propyl-2-pyridinyl) propanoate (CID 146561214) is (5-propyl-2-pyridinyl) propanoate.
What is the SMILES notation for (5-propyl-2-pyridinyl) propanoate?
The canonical SMILES for (5-propyl-2-pyridinyl) propanoate is CCCc1ccc(OC(=O)CC)nc1.
What is the InChIKey of (5-propyl-2-pyridinyl) propanoate?
The InChIKey is PLZKJKZJIUGOAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-3-5-9-6-7-10(12-8-9)14-11(13)4-2/h6-8H,3-5H2,1-2H3.
What are the key properties of (5-propyl-2-pyridinyl) propanoate?
(5-propyl-2-pyridinyl) propanoate has a molecular weight of 193.25 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-propyl-2-pyridinyl) propanoate is sourced from PubChem (CID 146561214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).