About 2-ethyl-5-propylpyridine
2-ethyl-5-propylpyridine (PubChem CID 23544341) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 2-ethyl-5-propylpyridine.
Molecular Properties
| Compound Name | 2-ethyl-5-propylpyridine |
| PubChem CID | 23544341 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 2-ethyl-5-propylpyridine |
| SMILES | CCCc1ccc(CC)nc1 |
| InChI | InChI=1S/C10H15N/c1-3-5-9-6-7-10(4-2)11-8-9/h6-8H,3-5H2,1-2H3 |
| InChIKey | GVGBVZIYDBKTMB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-5-propylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-propylpyridine?
The IUPAC name of 2-ethyl-5-propylpyridine (CID 23544341) is 2-ethyl-5-propylpyridine.
What is the SMILES notation for 2-ethyl-5-propylpyridine?
The canonical SMILES for 2-ethyl-5-propylpyridine is CCCc1ccc(CC)nc1.
What is the InChIKey of 2-ethyl-5-propylpyridine?
The InChIKey is GVGBVZIYDBKTMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-3-5-9-6-7-10(4-2)11-8-9/h6-8H,3-5H2,1-2H3.
What are the key properties of 2-ethyl-5-propylpyridine?
2-ethyl-5-propylpyridine has a molecular weight of 149.24 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-propylpyridine is sourced from PubChem (CID 23544341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).