C20H31N3 — CID 142247684
N,N-dimethyl-5-propylpyridin-2-amine;2-ethyl-5-propylpyridine (PubChem CID 142247684) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is N,N-dimethyl-5-propylpyridin-2-amine;2-ethyl-5-propylpyridine.
| Compound Name | N,N-dimethyl-5-propylpyridin-2-amine;2-ethyl-5-propylpyridine |
|---|---|
| PubChem CID | 142247684 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | N,N-dimethyl-5-propylpyridin-2-amine;2-ethyl-5-propylpyridine |
| SMILES | CCCc1ccc(CC)nc1.CCCc1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C10H16N2.C10H15N/c1-4-5-9-6-7-10(11-8-9)12(2)3;1-3-5-9-6-7-10(4-2)11-8-9/h6-8H,4-5H2,1-3H3;6-8H,3-5H2,1-2H3 |
| InChIKey | DDWOCEDLGJJDCF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |