About (5-bromo-2-pyridinyl) piperidine-4-carboxylate
(5-bromo-2-pyridinyl) piperidine-4-carboxylate (PubChem CID 153380500) has the molecular formula C11H13BrN2O2
and a molecular weight of 285.14 g/mol. Its IUPAC name is (5-bromo-2-pyridinyl) piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (5-bromo-2-pyridinyl) piperidine-4-carboxylate |
| PubChem CID | 153380500 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | (5-bromo-2-pyridinyl) piperidine-4-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cn1)C1CCNCC1 |
| InChI | InChI=1S/C11H13BrN2O2/c12-9-1-2-10(14-7-9)16-11(15)8-3-5-13-6-4-8/h1-2,7-8,13H,3-6H2 |
| InChIKey | PBDYJPWRBOWIFI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-bromo-2-pyridinyl) piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2-pyridinyl) piperidine-4-carboxylate?
The IUPAC name of (5-bromo-2-pyridinyl) piperidine-4-carboxylate (CID 153380500) is (5-bromo-2-pyridinyl) piperidine-4-carboxylate.
What is the SMILES notation for (5-bromo-2-pyridinyl) piperidine-4-carboxylate?
The canonical SMILES for (5-bromo-2-pyridinyl) piperidine-4-carboxylate is O=C(Oc1ccc(Br)cn1)C1CCNCC1.
What is the InChIKey of (5-bromo-2-pyridinyl) piperidine-4-carboxylate?
The InChIKey is PBDYJPWRBOWIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrN2O2/c12-9-1-2-10(14-7-9)16-11(15)8-3-5-13-6-4-8/h1-2,7-8,13H,3-6H2.
What are the key properties of (5-bromo-2-pyridinyl) piperidine-4-carboxylate?
(5-bromo-2-pyridinyl) piperidine-4-carboxylate has a molecular weight of 285.14 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2-pyridinyl) piperidine-4-carboxylate is sourced from PubChem (CID 153380500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).