About pyridin-2-yl piperidine-4-carboxylate;hydrochloride
pyridin-2-yl piperidine-4-carboxylate;hydrochloride (PubChem CID 174342486) has the molecular formula C11H15ClN2O2
and a molecular weight of 242.71 g/mol. Its IUPAC name is pyridin-2-yl piperidine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | pyridin-2-yl piperidine-4-carboxylate;hydrochloride |
| PubChem CID | 174342486 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | pyridin-2-yl piperidine-4-carboxylate;hydrochloride |
| SMILES | Cl.O=C(Oc1ccccn1)C1CCNCC1 |
| InChI | InChI=1S/C11H14N2O2.ClH/c14-11(9-4-7-12-8-5-9)15-10-3-1-2-6-13-10;/h1-3,6,9,12H,4-5,7-8H2;1H |
| InChIKey | GSQRHRPFULPUNI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-2-yl piperidine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl piperidine-4-carboxylate;hydrochloride?
The IUPAC name of pyridin-2-yl piperidine-4-carboxylate;hydrochloride (CID 174342486) is pyridin-2-yl piperidine-4-carboxylate;hydrochloride.
What is the SMILES notation for pyridin-2-yl piperidine-4-carboxylate;hydrochloride?
The canonical SMILES for pyridin-2-yl piperidine-4-carboxylate;hydrochloride is Cl.O=C(Oc1ccccn1)C1CCNCC1.
What is the InChIKey of pyridin-2-yl piperidine-4-carboxylate;hydrochloride?
The InChIKey is GSQRHRPFULPUNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2.ClH/c14-11(9-4-7-12-8-5-9)15-10-3-1-2-6-13-10;/h1-3,6,9,12H,4-5,7-8H2;1H.
What are the key properties of pyridin-2-yl piperidine-4-carboxylate;hydrochloride?
pyridin-2-yl piperidine-4-carboxylate;hydrochloride has a molecular weight of 242.71 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl piperidine-4-carboxylate;hydrochloride is sourced from PubChem (CID 174342486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).