About pyridin-2-yl N-(azetidin-3-yl)carbamate
pyridin-2-yl N-(azetidin-3-yl)carbamate (PubChem CID 175981988) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is pyridin-2-yl N-(azetidin-3-yl)carbamate.
Molecular Properties
| Compound Name | pyridin-2-yl N-(azetidin-3-yl)carbamate |
| PubChem CID | 175981988 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | pyridin-2-yl N-(azetidin-3-yl)carbamate |
| SMILES | O=C(NC1CNC1)Oc1ccccn1 |
| InChI | InChI=1S/C9H11N3O2/c13-9(12-7-5-10-6-7)14-8-3-1-2-4-11-8/h1-4,7,10H,5-6H2,(H,12,13) |
| InChIKey | PTYDXPMRTYUFDA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-2-yl N-(azetidin-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl N-(azetidin-3-yl)carbamate?
The IUPAC name of pyridin-2-yl N-(azetidin-3-yl)carbamate (CID 175981988) is pyridin-2-yl N-(azetidin-3-yl)carbamate.
What is the SMILES notation for pyridin-2-yl N-(azetidin-3-yl)carbamate?
The canonical SMILES for pyridin-2-yl N-(azetidin-3-yl)carbamate is O=C(NC1CNC1)Oc1ccccn1.
What is the InChIKey of pyridin-2-yl N-(azetidin-3-yl)carbamate?
The InChIKey is PTYDXPMRTYUFDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c13-9(12-7-5-10-6-7)14-8-3-1-2-4-11-8/h1-4,7,10H,5-6H2,(H,12,13).
What are the key properties of pyridin-2-yl N-(azetidin-3-yl)carbamate?
pyridin-2-yl N-(azetidin-3-yl)carbamate has a molecular weight of 193.21 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl N-(azetidin-3-yl)carbamate is sourced from PubChem (CID 175981988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).