About potassium;hydride;pyridin-2-yl cyclobutanecarboxylate
potassium;hydride;pyridin-2-yl cyclobutanecarboxylate (PubChem CID 175231447) has the molecular formula C10H12KNO2
and a molecular weight of 217.31 g/mol. Its IUPAC name is potassium;hydride;pyridin-2-yl cyclobutanecarboxylate.
Molecular Properties
| Compound Name | potassium;hydride;pyridin-2-yl cyclobutanecarboxylate |
| PubChem CID | 175231447 |
| Molecular Formula | C10H12KNO2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | potassium;hydride;pyridin-2-yl cyclobutanecarboxylate |
| SMILES | O=C(Oc1ccccn1)C1CCC1.[H-].[K+] |
| InChI | InChI=1S/C10H11NO2.K.H/c12-10(8-4-3-5-8)13-9-6-1-2-7-11-9;;/h1-2,6-8H,3-5H2;;/q;+1;-1 |
| InChIKey | IIHWFKFVGBKDGR-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;hydride;pyridin-2-yl cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;pyridin-2-yl cyclobutanecarboxylate?
The IUPAC name of potassium;hydride;pyridin-2-yl cyclobutanecarboxylate (CID 175231447) is potassium;hydride;pyridin-2-yl cyclobutanecarboxylate.
What is the SMILES notation for potassium;hydride;pyridin-2-yl cyclobutanecarboxylate?
The canonical SMILES for potassium;hydride;pyridin-2-yl cyclobutanecarboxylate is O=C(Oc1ccccn1)C1CCC1.[H-].[K+].
What is the InChIKey of potassium;hydride;pyridin-2-yl cyclobutanecarboxylate?
The InChIKey is IIHWFKFVGBKDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.K.H/c12-10(8-4-3-5-8)13-9-6-1-2-7-11-9;;/h1-2,6-8H,3-5H2;;/q;+1;-1.
What are the key properties of potassium;hydride;pyridin-2-yl cyclobutanecarboxylate?
potassium;hydride;pyridin-2-yl cyclobutanecarboxylate has a molecular weight of 217.31 g/mol, XLogP of -1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;pyridin-2-yl cyclobutanecarboxylate is sourced from PubChem (CID 175231447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).