C19H28N2O2S — CID 101206913
N-[(1S,2S)-2-[bis(prop-2-enyl)amino]cyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 101206913) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is N-[(1S,2S)-2-[bis(prop-2-enyl)amino]cyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-[bis(prop-2-enyl)amino]cyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101206913 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | N-[(1S,2S)-2-[bis(prop-2-enyl)amino]cyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | C=CCN(CC=C)[C@H]1CCCC[C@@H]1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H28N2O2S/c1-4-14-21(15-5-2)19-9-7-6-8-18(19)20-24(22,23)17-12-10-16(3)11-13-17/h4-5,10-13,18-20H,1-2,6-9,14-15H2,3H3/t18-,19-/m0/s1 |
| InChIKey | RGAJZNHWKMXNMR-OALUTQOASA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|