C23H30N2O4S2 — CID 11576275
2-methyl-N-[(1R,2S)-2-[(2-methylphenyl)sulfonyl-prop-2-enylamino]cyclohexyl]benzenesulfonamide (PubChem CID 11576275) has the molecular formula C23H30N2O4S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 2-methyl-N-[(1R,2S)-2-[(2-methylphenyl)sulfonyl-prop-2-enylamino]cyclohexyl]benzenesulfonamide.
| Compound Name | 2-methyl-N-[(1R,2S)-2-[(2-methylphenyl)sulfonyl-prop-2-enylamino]cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11576275 |
| Molecular Formula | C23H30N2O4S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-methyl-N-[(1R,2S)-2-[(2-methylphenyl)sulfonyl-prop-2-enylamino]cyclohexyl]benzenesulfonamide |
| SMILES | C=CCN([C@H]1CCCC[C@H]1NS(=O)(=O)c1ccccc1C)S(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C23H30N2O4S2/c1-4-17-25(31(28,29)23-16-10-6-12-19(23)3)21-14-8-7-13-20(21)24-30(26,27)22-15-9-5-11-18(22)2/h4-6,9-12,15-16,20-21,24H,1,7-8,13-14,17H2,2-3H3/t20-,21+/m1/s1 |
| InChIKey | CASXMAAPGVYIHG-RTWAWAEBSA-N |
| XLogP | 3.77 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|