C20H26N2O2S — CID 23604948
N-[2-(N,4-dimethylanilino)cyclohexyl]benzenesulfonamide (PubChem CID 23604948) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[2-(N,4-dimethylanilino)cyclohexyl]benzenesulfonamide.
| Compound Name | N-[2-(N,4-dimethylanilino)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23604948 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[2-(N,4-dimethylanilino)cyclohexyl]benzenesulfonamide |
| SMILES | Cc1ccc(N(C)C2CCCCC2NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-16-12-14-17(15-13-16)22(2)20-11-7-6-10-19(20)21-25(23,24)18-8-4-3-5-9-18/h3-5,8-9,12-15,19-21H,6-7,10-11H2,1-2H3 |
| InChIKey | HGJVBFDVVIVVPC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|