C20H25ClN2O2S — CID 98467664
4-chloro-N-[(1R,2R)-2-(N,3-dimethylanilino)cyclohexyl]benzenesulfonamide (PubChem CID 98467664) has the molecular formula C20H25ClN2O2S and a molecular weight of 392.95 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2R)-2-(N,3-dimethylanilino)cyclohexyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(1R,2R)-2-(N,3-dimethylanilino)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 98467664 |
| Molecular Formula | C20H25ClN2O2S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4-chloro-N-[(1R,2R)-2-(N,3-dimethylanilino)cyclohexyl]benzenesulfonamide |
| SMILES | Cc1cccc(N(C)[C@@H]2CCCC[C@H]2NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H25ClN2O2S/c1-15-6-5-7-17(14-15)23(2)20-9-4-3-8-19(20)22-26(24,25)18-12-10-16(21)11-13-18/h5-7,10-14,19-20,22H,3-4,8-9H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | YEOABFZJGCIOFY-WOJBJXKFSA-N |
| XLogP | 4.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |