C21H27ClN2O2S — CID 124772278
N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide (PubChem CID 124772278) has the molecular formula C21H27ClN2O2S and a molecular weight of 406.98 g/mol. Its IUPAC name is N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 124772278 |
| Molecular Formula | C21H27ClN2O2S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide |
| SMILES | CCN(Cc1ccccc1)[C@@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN2O2S/c1-2-24(16-17-8-4-3-5-9-17)21-11-7-6-10-20(21)23-27(25,26)19-14-12-18(22)13-15-19/h3-5,8-9,12-15,20-21,23H,2,6-7,10-11,16H2,1H3/t20-,21-/m1/s1 |
| InChIKey | SUXNLXCDPSSYAD-NHCUHLMSSA-N |
| XLogP | 4.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |