About N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide
N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide (PubChem CID 124772278) has the molecular formula C21H27ClN2O2S
and a molecular weight of 406.98 g/mol. Its IUPAC name is N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide |
| PubChem CID | 124772278 |
| Molecular Formula | C21H27ClN2O2S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide |
| SMILES | CCN(Cc1ccccc1)[C@@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN2O2S/c1-2-24(16-17-8-4-3-5-9-17)21-11-7-6-10-20(21)23-27(25,26)19-14-12-18(22)13-15-19/h3-5,8-9,12-15,20-21,23H,2,6-7,10-11,16H2,1H3/t20-,21-/m1/s1 |
| InChIKey | SUXNLXCDPSSYAD-NHCUHLMSSA-N |
| XLogP | 4.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide?
The IUPAC name of N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide (CID 124772278) is N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide.
What is the SMILES notation for N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide?
The canonical SMILES for N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide is CCN(Cc1ccccc1)[C@@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide?
The InChIKey is SUXNLXCDPSSYAD-NHCUHLMSSA-N. The full InChI is InChI=1S/C21H27ClN2O2S/c1-2-24(16-17-8-4-3-5-9-17)21-11-7-6-10-20(21)23-27(25,26)19-14-12-18(22)13-15-19/h3-5,8-9,12-15,20-21,23H,2,6-7,10-11,16H2,1H3/t20-,21-/m1/s1.
What are the key properties of N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide?
N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide has a molecular weight of 406.98 g/mol, XLogP of 4.45, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-[benzyl(ethyl)amino]cyclohexyl]-4-chlorobenzenesulfonamide is sourced from PubChem (CID 124772278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).