C15H23NO — CID 102731816
trans-(1S,2S)-2-[benzyl(ethyl)amino]cyclohexan-1-ol (PubChem CID 102731816) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is trans-(1S,2S)-2-[benzyl(ethyl)amino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[benzyl(ethyl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731816 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | trans-(1S,2S)-2-[benzyl(ethyl)amino]cyclohexan-1-ol |
| SMILES | CCN(Cc1ccccc1)[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C15H23NO/c1-2-16(12-13-8-4-3-5-9-13)14-10-6-7-11-15(14)17/h3-5,8-9,14-15,17H,2,6-7,10-12H2,1H3/t14-,15-/m0/s1 |
| InChIKey | LJVFXDUUSUEMTN-GJZGRUSLSA-N |
| XLogP | 2.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |