C21H26FNO — CID 71500771
(1S,2R,7S)-2-(dibenzylamino)-7-fluorocycloheptan-1-ol (PubChem CID 71500771) has the molecular formula C21H26FNO and a molecular weight of 327.44 g/mol. Its IUPAC name is (1S,2R,7S)-2-(dibenzylamino)-7-fluorocycloheptan-1-ol.
| Compound Name | (1S,2R,7S)-2-(dibenzylamino)-7-fluorocycloheptan-1-ol |
|---|---|
| PubChem CID | 71500771 |
| Molecular Formula | C21H26FNO |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | (1S,2R,7S)-2-(dibenzylamino)-7-fluorocycloheptan-1-ol |
| SMILES | O[C@H]1[C@H](N(Cc2ccccc2)Cc2ccccc2)CCCC[C@@H]1F |
| InChI | InChI=1S/C21H26FNO/c22-19-13-7-8-14-20(21(19)24)23(15-17-9-3-1-4-10-17)16-18-11-5-2-6-12-18/h1-6,9-12,19-21,24H,7-8,13-16H2/t19-,20+,21+/m0/s1 |
| InChIKey | ODUKFEJQADUMGP-PWRODBHTSA-N |
| XLogP | 4.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |