C40H40N4 — CID 102375757
trans-(1R,2R)-1-N,2-N-dibenzyl-1-N,2-N-bis(quinolin-2-ylmethyl)cyclohexane-1,2-diamine (PubChem CID 102375757) has the molecular formula C40H40N4 and a molecular weight of 576.79 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-dibenzyl-1-N,2-N-bis(quinolin-2-ylmethyl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-dibenzyl-1-N,2-N-bis(quinolin-2-ylmethyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 102375757 |
| Molecular Formula | C40H40N4 |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-dibenzyl-1-N,2-N-bis(quinolin-2-ylmethyl)cyclohexane-1,2-diamine |
| SMILES | c1ccc(CN(Cc2ccc3ccccc3n2)[C@@H]2CCCC[C@H]2N(Cc2ccccc2)Cc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C40H40N4/c1-3-13-31(14-4-1)27-43(29-35-25-23-33-17-7-9-19-37(33)41-35)39-21-11-12-22-40(39)44(28-32-15-5-2-6-16-32)30-36-26-24-34-18-8-10-20-38(34)42-36/h1-10,13-20,23-26,39-40H,11-12,21-22,27-30H2/t39-,40-/m1/s1 |
| InChIKey | ZCWBTRYGOYGRJV-XRSDMRJBSA-N |
| XLogP | 8.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |