C26H28N4 — CID 70905536
trans-(1S,2S)-1-N,2-N-bis(quinolin-2-ylmethyl)cyclohexane-1,2-diamine (PubChem CID 70905536) has the molecular formula C26H28N4 and a molecular weight of 396.54 g/mol. Its IUPAC name is trans-(1S,2S)-1-N,2-N-bis(quinolin-2-ylmethyl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1S,2S)-1-N,2-N-bis(quinolin-2-ylmethyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 70905536 |
| Molecular Formula | C26H28N4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | trans-(1S,2S)-1-N,2-N-bis(quinolin-2-ylmethyl)cyclohexane-1,2-diamine |
| SMILES | c1ccc2nc(CN[C@H]3CCCC[C@@H]3NCc3ccc4ccccc4n3)ccc2c1 |
| InChI | InChI=1S/C26H28N4/c1-3-9-23-19(7-1)13-15-21(29-23)17-27-25-11-5-6-12-26(25)28-18-22-16-14-20-8-2-4-10-24(20)30-22/h1-4,7-10,13-16,25-28H,5-6,11-12,17-18H2/t25-,26-/m0/s1 |
| InChIKey | VPUZYGDWRCZFSL-UIOOFZCWSA-N |
| XLogP | 4.97 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |