C23H23Cl2N3O — CID 90644994
N-[(1R,2S)-2-[(3,4-dichlorophenyl)methylamino]cyclohexyl]quinoline-2-carboxamide (PubChem CID 90644994) has the molecular formula C23H23Cl2N3O and a molecular weight of 428.36 g/mol. Its IUPAC name is N-[(1R,2S)-2-[(3,4-dichlorophenyl)methylamino]cyclohexyl]quinoline-2-carboxamide.
| Compound Name | N-[(1R,2S)-2-[(3,4-dichlorophenyl)methylamino]cyclohexyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 90644994 |
| Molecular Formula | C23H23Cl2N3O |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-[(1R,2S)-2-[(3,4-dichlorophenyl)methylamino]cyclohexyl]quinoline-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H]1NCc1ccc(Cl)c(Cl)c1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C23H23Cl2N3O/c24-17-11-9-15(13-18(17)25)14-26-20-7-3-4-8-21(20)28-23(29)22-12-10-16-5-1-2-6-19(16)27-22/h1-2,5-6,9-13,20-21,26H,3-4,7-8,14H2,(H,28,29)/t20-,21+/m0/s1 |
| InChIKey | UQVWDVRFHVVWFZ-LEWJYISDSA-N |
| XLogP | 5.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |