C18H14ClN3O2 — CID 29266373
N'-[2-(2-chlorophenyl)acetyl]quinoline-2-carbohydrazide (PubChem CID 29266373) has the molecular formula C18H14ClN3O2 and a molecular weight of 339.78 g/mol. Its IUPAC name is N'-[2-(2-chlorophenyl)acetyl]quinoline-2-carbohydrazide.
| Compound Name | N'-[2-(2-chlorophenyl)acetyl]quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 29266373 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N'-[2-(2-chlorophenyl)acetyl]quinoline-2-carbohydrazide |
| SMILES | O=C(Cc1ccccc1Cl)NNC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H14ClN3O2/c19-14-7-3-1-6-13(14)11-17(23)21-22-18(24)16-10-9-12-5-2-4-8-15(12)20-16/h1-10H,11H2,(H,21,23)(H,22,24) |
| InChIKey | RGSBHDZNHCTSCD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|