C19H14N4O3 — CID 35069552
N'-[2-(1,2-benzoxazol-3-yl)acetyl]quinoline-2-carbohydrazide (PubChem CID 35069552) has the molecular formula C19H14N4O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is N'-[2-(1,2-benzoxazol-3-yl)acetyl]quinoline-2-carbohydrazide.
| Compound Name | N'-[2-(1,2-benzoxazol-3-yl)acetyl]quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 35069552 |
| Molecular Formula | C19H14N4O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N'-[2-(1,2-benzoxazol-3-yl)acetyl]quinoline-2-carbohydrazide |
| SMILES | O=C(Cc1noc2ccccc12)NNC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H14N4O3/c24-18(11-16-13-6-2-4-8-17(13)26-23-16)21-22-19(25)15-10-9-12-5-1-3-7-14(12)20-15/h1-10H,11H2,(H,21,24)(H,22,25) |
| InChIKey | GVEXNWISDOWVIN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|