C14H13N3O2 — CID 26798961
N'-(cyclopropanecarbonyl)quinoline-2-carbohydrazide (PubChem CID 26798961) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is N'-(cyclopropanecarbonyl)quinoline-2-carbohydrazide.
| Compound Name | N'-(cyclopropanecarbonyl)quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 26798961 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N'-(cyclopropanecarbonyl)quinoline-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C14H13N3O2/c18-13(10-5-6-10)16-17-14(19)12-8-7-9-3-1-2-4-11(9)15-12/h1-4,7-8,10H,5-6H2,(H,16,18)(H,17,19) |
| InChIKey | QSRUHYCOMDBDJC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|