C21H20N4O4 — CID 51933923
N'-[(3R)-1-(furan-3-carbonyl)piperidine-3-carbonyl]quinoline-2-carbohydrazide (PubChem CID 51933923) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is N'-[(3R)-1-(furan-3-carbonyl)piperidine-3-carbonyl]quinoline-2-carbohydrazide.
| Compound Name | N'-[(3R)-1-(furan-3-carbonyl)piperidine-3-carbonyl]quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 51933923 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N'-[(3R)-1-(furan-3-carbonyl)piperidine-3-carbonyl]quinoline-2-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1CCCN(C(=O)c2ccoc2)C1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H20N4O4/c26-19(15-5-3-10-25(12-15)21(28)16-9-11-29-13-16)23-24-20(27)18-8-7-14-4-1-2-6-17(14)22-18/h1-2,4,6-9,11,13,15H,3,5,10,12H2,(H,23,26)(H,24,27)/t15-/m1/s1 |
| InChIKey | NPIGGWCSMWDJPP-OAHLLOKOSA-N |
| XLogP | 2.14 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|