C22H22ClN3O2 — CID 53307897
4-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2R)-2-hydroxycyclohexyl]quinoline-2-carboxamide (PubChem CID 53307897) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2R)-2-hydroxycyclohexyl]quinoline-2-carboxamide.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2R)-2-hydroxycyclohexyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 53307897 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2R)-2-hydroxycyclohexyl]quinoline-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@H]1O)c1cc(Cc2ccc(Cl)nc2)c2ccccc2n1 |
| InChI | InChI=1S/C22H22ClN3O2/c23-21-10-9-14(13-24-21)11-15-12-19(25-17-6-2-1-5-16(15)17)22(28)26-18-7-3-4-8-20(18)27/h1-2,5-6,9-10,12-13,18,20,27H,3-4,7-8,11H2,(H,26,28)/t18-,20+/m0/s1 |
| InChIKey | VPMUJEOFHFOHAZ-AZUAARDMSA-N |
| XLogP | 3.91 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|