C25H28ClN3O2 — CID 130441262
4-[(6-chloro-3-pyridinyl)methyl]-N-[(2S)-2-hydroxycyclohexyl]-1-(methylaminomethyl)naphthalene-2-carboxamide (PubChem CID 130441262) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-N-[(2S)-2-hydroxycyclohexyl]-1-(methylaminomethyl)naphthalene-2-carboxamide.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-N-[(2S)-2-hydroxycyclohexyl]-1-(methylaminomethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 130441262 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-N-[(2S)-2-hydroxycyclohexyl]-1-(methylaminomethyl)naphthalene-2-carboxamide |
| SMILES | CNCc1c(C(=O)NC2CCCC[C@@H]2O)cc(Cc2ccc(Cl)nc2)c2ccccc12 |
| InChI | InChI=1S/C25H28ClN3O2/c1-27-15-21-19-7-3-2-6-18(19)17(12-16-10-11-24(26)28-14-16)13-20(21)25(31)29-22-8-4-5-9-23(22)30/h2-3,6-7,10-11,13-14,22-23,27,30H,4-5,8-9,12,15H2,1H3,(H,29,31)/t22?,23-/m0/s1 |
| InChIKey | RCIHREDONFFBEM-WCSIJFPASA-N |
| XLogP | 4.23 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|