C23H24ClN3O2 — CID 130229233
8-amino-5-[(4-chlorophenyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]quinoline-7-carboxamide (PubChem CID 130229233) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 8-amino-5-[(4-chlorophenyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]quinoline-7-carboxamide.
| Compound Name | 8-amino-5-[(4-chlorophenyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 130229233 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 8-amino-5-[(4-chlorophenyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]quinoline-7-carboxamide |
| SMILES | Nc1c(C(=O)N[C@H]2CCCC[C@@H]2O)cc(Cc2ccc(Cl)cc2)c2cccnc12 |
| InChI | InChI=1S/C23H24ClN3O2/c24-16-9-7-14(8-10-16)12-15-13-18(21(25)22-17(15)4-3-11-26-22)23(29)27-19-5-1-2-6-20(19)28/h3-4,7-11,13,19-20,28H,1-2,5-6,12,25H2,(H,27,29)/t19-,20-/m0/s1 |
| InChIKey | WQXPQOPSHAQVHX-PMACEKPBSA-N |
| XLogP | 4.09 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|