C21H24ClN5O2 — CID 130407532
4-amino-7-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-3-methylbenzimidazole-5-carboxamide (PubChem CID 130407532) has the molecular formula C21H24ClN5O2 and a molecular weight of 413.91 g/mol. Its IUPAC name is 4-amino-7-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-3-methylbenzimidazole-5-carboxamide.
| Compound Name | 4-amino-7-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-3-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 130407532 |
| Molecular Formula | C21H24ClN5O2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-amino-7-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-3-methylbenzimidazole-5-carboxamide |
| SMILES | Cn1cnc2c(Cc3ccc(Cl)nc3)cc(C(=O)N[C@H]3CCCC[C@@H]3O)c(N)c21 |
| InChI | InChI=1S/C21H24ClN5O2/c1-27-11-25-19-13(8-12-6-7-17(22)24-10-12)9-14(18(23)20(19)27)21(29)26-15-4-2-3-5-16(15)28/h6-7,9-11,15-16,28H,2-5,8,23H2,1H3,(H,26,29)/t15-,16-/m0/s1 |
| InChIKey | ILFIUULKHDESMD-HOTGVXAUSA-N |
| XLogP | 2.83 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|